C18H22N2O4 — CID 91580347
2-heptyl-5,7-dihydroxy-6-methylpyrrolo[3,4-f]isoindole-1,3-dione (PubChem CID 91580347) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-heptyl-5,7-dihydroxy-6-methylpyrrolo[3,4-f]isoindole-1,3-dione.
| Compound Name | 2-heptyl-5,7-dihydroxy-6-methylpyrrolo[3,4-f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91580347 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-heptyl-5,7-dihydroxy-6-methylpyrrolo[3,4-f]isoindole-1,3-dione |
| SMILES | CCCCCCCN1C(=O)c2cc3c(O)n(C)c(O)c3cc2C1=O |
| InChI | InChI=1S/C18H22N2O4/c1-3-4-5-6-7-8-20-17(23)13-9-11-12(10-14(13)18(20)24)16(22)19(2)15(11)21/h9-10,21-22H,3-8H2,1-2H3 |
| InChIKey | NUDZYFTWYSZZMI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|