C21H16F8N2O4 — CID 123411410
2-[6-(3-ethenyl-2,5-dihydroxy-4-methylpyrrol-1-yl)-2,2,3,3,4,4,5,5-octafluorohexyl]isoindole-1,3-dione (PubChem CID 123411410) has the molecular formula C21H16F8N2O4 and a molecular weight of 512.35 g/mol. Its IUPAC name is 2-[6-(3-ethenyl-2,5-dihydroxy-4-methylpyrrol-1-yl)-2,2,3,3,4,4,5,5-octafluorohexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-(3-ethenyl-2,5-dihydroxy-4-methylpyrrol-1-yl)-2,2,3,3,4,4,5,5-octafluorohexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 123411410 |
| Molecular Formula | C21H16F8N2O4 |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 2-[6-(3-ethenyl-2,5-dihydroxy-4-methylpyrrol-1-yl)-2,2,3,3,4,4,5,5-octafluorohexyl]isoindole-1,3-dione |
| SMILES | C=Cc1c(C)c(O)n(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)CN2C(=O)c3ccccc3C2=O)c1O |
| InChI | InChI=1S/C21H16F8N2O4/c1-3-11-10(2)14(32)30(15(11)33)8-18(22,23)20(26,27)21(28,29)19(24,25)9-31-16(34)12-6-4-5-7-13(12)17(31)35/h3-7,32-33H,1,8-9H2,2H3 |
| InChIKey | TXOHLKNVSDOIKW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|