C21H14F6N2O3 — CID 91498869
5-[1,1,1,3,3,3-hexafluoro-2-(1-hydroxy-2-methylisoindol-5-yl)propan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 91498869) has the molecular formula C21H14F6N2O3 and a molecular weight of 456.34 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-(1-hydroxy-2-methylisoindol-5-yl)propan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-(1-hydroxy-2-methylisoindol-5-yl)propan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 91498869 |
| Molecular Formula | C21H14F6N2O3 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-(1-hydroxy-2-methylisoindol-5-yl)propan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | CN1C(=O)c2ccc(C(c3ccc4c(O)n(C)cc4c3)(C(F)(F)F)C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C21H14F6N2O3/c1-28-9-10-7-11(3-5-13(10)16(28)30)19(20(22,23)24,21(25,26)27)12-4-6-14-15(8-12)18(32)29(2)17(14)31/h3-9,30H,1-2H3 |
| InChIKey | REKJPMDRHFUXET-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|