C24H28FN3O2 — CID 91155078
2-[(4-fluorophenyl)methyl]-3-hydroxy-N-(3-piperidin-1-ylpropyl)isoindole-5-carboxamide (PubChem CID 91155078) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3-hydroxy-N-(3-piperidin-1-ylpropyl)isoindole-5-carboxamide.
| Compound Name | 2-[(4-fluorophenyl)methyl]-3-hydroxy-N-(3-piperidin-1-ylpropyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 91155078 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3-hydroxy-N-(3-piperidin-1-ylpropyl)isoindole-5-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)c1ccc2cn(Cc3ccc(F)cc3)c(O)c2c1 |
| InChI | InChI=1S/C24H28FN3O2/c25-21-9-5-18(6-10-21)16-28-17-20-8-7-19(15-22(20)24(28)30)23(29)26-11-4-14-27-12-2-1-3-13-27/h5-10,15,17,30H,1-4,11-14,16H2,(H,26,29) |
| InChIKey | XTGUPUQCAVFNTH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|