C33H34F3N3O2 — CID 54407434
9-[4-[4-(1-hydroxyisoindol-2-yl)piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 54407434) has the molecular formula C33H34F3N3O2 and a molecular weight of 561.65 g/mol. Its IUPAC name is 9-[4-[4-(1-hydroxyisoindol-2-yl)piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-(1-hydroxyisoindol-2-yl)piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 54407434 |
| Molecular Formula | C33H34F3N3O2 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | 9-[4-[4-(1-hydroxyisoindol-2-yl)piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCN2CCC(n3cc4ccccc4c3O)CC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H34F3N3O2/c34-33(35,36)22-37-31(41)32(28-13-5-3-11-26(28)27-12-4-6-14-29(27)32)17-7-8-18-38-19-15-24(16-20-38)39-21-23-9-1-2-10-25(23)30(39)40/h1-6,9-14,21,24,40H,7-8,15-20,22H2,(H,37,41) |
| InChIKey | VRSIGMLHBDLWQA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|