C27H34FN3O2 — CID 91090160
2-[(3-fluorophenyl)methyl]-3-hydroxy-N-[3-(2-propylpiperidin-1-yl)propyl]isoindole-5-carboxamide (PubChem CID 91090160) has the molecular formula C27H34FN3O2 and a molecular weight of 451.59 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-3-hydroxy-N-[3-(2-propylpiperidin-1-yl)propyl]isoindole-5-carboxamide.
| Compound Name | 2-[(3-fluorophenyl)methyl]-3-hydroxy-N-[3-(2-propylpiperidin-1-yl)propyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 91090160 |
| Molecular Formula | C27H34FN3O2 |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-3-hydroxy-N-[3-(2-propylpiperidin-1-yl)propyl]isoindole-5-carboxamide |
| SMILES | CCCC1CCCCN1CCCNC(=O)c1ccc2cn(Cc3cccc(F)c3)c(O)c2c1 |
| InChI | InChI=1S/C27H34FN3O2/c1-2-7-24-10-3-4-14-30(24)15-6-13-29-26(32)21-11-12-22-19-31(27(33)25(22)17-21)18-20-8-5-9-23(28)16-20/h5,8-9,11-12,16-17,19,24,33H,2-4,6-7,10,13-15,18H2,1H3,(H,29,32) |
| InChIKey | MHAGFIVUSKCRSB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|