C28H36FN3O2 — CID 90702016
N-[3-(2-butylpiperidin-1-yl)propyl]-2-[(3-fluorophenyl)methyl]-3-hydroxyisoindole-5-carboxamide (PubChem CID 90702016) has the molecular formula C28H36FN3O2 and a molecular weight of 465.61 g/mol. Its IUPAC name is N-[3-(2-butylpiperidin-1-yl)propyl]-2-[(3-fluorophenyl)methyl]-3-hydroxyisoindole-5-carboxamide.
| Compound Name | N-[3-(2-butylpiperidin-1-yl)propyl]-2-[(3-fluorophenyl)methyl]-3-hydroxyisoindole-5-carboxamide |
|---|---|
| PubChem CID | 90702016 |
| Molecular Formula | C28H36FN3O2 |
| Molecular Weight | 465.61 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | N-[3-(2-butylpiperidin-1-yl)propyl]-2-[(3-fluorophenyl)methyl]-3-hydroxyisoindole-5-carboxamide |
| SMILES | CCCCC1CCCCN1CCCNC(=O)c1ccc2cn(Cc3cccc(F)c3)c(O)c2c1 |
| InChI | InChI=1S/C28H36FN3O2/c1-2-3-10-25-11-4-5-15-31(25)16-7-14-30-27(33)22-12-13-23-20-32(28(34)26(23)18-22)19-21-8-6-9-24(29)17-21/h6,8-9,12-13,17-18,20,25,34H,2-5,7,10-11,14-16,19H2,1H3,(H,30,33) |
| InChIKey | SSIAGEUCBHSTLP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|