C18H15N3O4 — CID 973227
N-benzoylimino-2-ethyl-1,3-dihydroxyisoindole-5-carboxamide (PubChem CID 973227) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is N-benzoylimino-2-ethyl-1,3-dihydroxyisoindole-5-carboxamide.
| Compound Name | N-benzoylimino-2-ethyl-1,3-dihydroxyisoindole-5-carboxamide |
|---|---|
| PubChem CID | 973227 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-benzoylimino-2-ethyl-1,3-dihydroxyisoindole-5-carboxamide |
| SMILES | CCn1c(O)c2ccc(C(=O)/N=N/C(=O)c3ccccc3)cc2c1O |
| InChI | InChI=1S/C18H15N3O4/c1-2-21-17(24)13-9-8-12(10-14(13)18(21)25)16(23)20-19-15(22)11-6-4-3-5-7-11/h3-10,24-25H,2H2,1H3/b20-19+ |
| InChIKey | DGIZVMQZCVAIKQ-FMQUCBEESA-N |
| XLogP | 3.51 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|