C20H16FN3O5 — CID 135894110
N-[2-(2-fluorophenoxy)acetyl]imino-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 135894110) has the molecular formula C20H16FN3O5 and a molecular weight of 397.36 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)acetyl]imino-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | N-[2-(2-fluorophenoxy)acetyl]imino-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 135894110 |
| Molecular Formula | C20H16FN3O5 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-[2-(2-fluorophenoxy)acetyl]imino-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCn1c(O)c2ccc(C(=O)/N=N/C(=O)COc3ccccc3F)cc2c1O |
| InChI | InChI=1S/C20H16FN3O5/c1-2-9-24-19(27)13-8-7-12(10-14(13)20(24)28)18(26)23-22-17(25)11-29-16-6-4-3-5-15(16)21/h2-8,10,27-28H,1,9,11H2/b23-22+ |
| InChIKey | IFTODFJVZVWTSU-GHVJWSGMSA-N |
| XLogP | 3.58 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|