C17H14FNO4 — CID 123513242
4-fluoro-1-hydroxy-2-[(4-methoxyphenyl)methyl]isoindole-5-carboxylic acid (PubChem CID 123513242) has the molecular formula C17H14FNO4 and a molecular weight of 315.30 g/mol. Its IUPAC name is 4-fluoro-1-hydroxy-2-[(4-methoxyphenyl)methyl]isoindole-5-carboxylic acid.
| Compound Name | 4-fluoro-1-hydroxy-2-[(4-methoxyphenyl)methyl]isoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 123513242 |
| Molecular Formula | C17H14FNO4 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-fluoro-1-hydroxy-2-[(4-methoxyphenyl)methyl]isoindole-5-carboxylic acid |
| SMILES | COc1ccc(Cn2cc3c(F)c(C(=O)O)ccc3c2O)cc1 |
| InChI | InChI=1S/C17H14FNO4/c1-23-11-4-2-10(3-5-11)8-19-9-14-12(16(19)20)6-7-13(15(14)18)17(21)22/h2-7,9,20H,8H2,1H3,(H,21,22) |
| InChIKey | UEZLEGPSMZHGLB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |