C20H18FN3O4 — CID 2667331
2-butyl-N-(2-fluorobenzoyl)imino-1,3-dihydroxyisoindole-5-carboxamide (PubChem CID 2667331) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is 2-butyl-N-(2-fluorobenzoyl)imino-1,3-dihydroxyisoindole-5-carboxamide.
| Compound Name | 2-butyl-N-(2-fluorobenzoyl)imino-1,3-dihydroxyisoindole-5-carboxamide |
|---|---|
| PubChem CID | 2667331 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-butyl-N-(2-fluorobenzoyl)imino-1,3-dihydroxyisoindole-5-carboxamide |
| SMILES | CCCCn1c(O)c2ccc(C(=O)/N=N/C(=O)c3ccccc3F)cc2c1O |
| InChI | InChI=1S/C20H18FN3O4/c1-2-3-10-24-19(27)13-9-8-12(11-15(13)20(24)28)17(25)22-23-18(26)14-6-4-5-7-16(14)21/h4-9,11,27-28H,2-3,10H2,1H3/b23-22+ |
| InChIKey | FXAJDAGWNHAZGV-GHVJWSGMSA-N |
| XLogP | 4.42 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|