C19H14F2N4O4 — CID 90843944
6-fluoro-2-[[4-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]methyl]-1-hydroxyisoindole-5-carboxamide (PubChem CID 90843944) has the molecular formula C19H14F2N4O4 and a molecular weight of 400.34 g/mol. Its IUPAC name is 6-fluoro-2-[[4-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]methyl]-1-hydroxyisoindole-5-carboxamide.
| Compound Name | 6-fluoro-2-[[4-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]methyl]-1-hydroxyisoindole-5-carboxamide |
|---|---|
| PubChem CID | 90843944 |
| Molecular Formula | C19H14F2N4O4 |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 6-fluoro-2-[[4-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]methyl]-1-hydroxyisoindole-5-carboxamide |
| SMILES | NC(=O)c1cc2cn(CC3(c4ccc(F)cc4)NC(=O)NC3=O)c(O)c2cc1F |
| InChI | InChI=1S/C19H14F2N4O4/c20-11-3-1-10(2-4-11)19(17(28)23-18(29)24-19)8-25-7-9-5-13(15(22)26)14(21)6-12(9)16(25)27/h1-7,27H,8H2,(H2,22,26)(H2,23,24,28,29) |
| InChIKey | YFJOJQHQLAVOIK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|