C22H18F3N3O4 — CID 90958109
N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-(trifluoromethyl)benzamide (PubChem CID 90958109) has the molecular formula C22H18F3N3O4 and a molecular weight of 445.40 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90958109 |
| Molecular Formula | C22H18F3N3O4 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C1CCC(n2cc3cc(CNC(=O)c4cccc(C(F)(F)F)c4)ccc3c2O)C(=O)N1 |
| InChI | InChI=1S/C22H18F3N3O4/c23-22(24,25)15-3-1-2-13(9-15)19(30)26-10-12-4-5-16-14(8-12)11-28(21(16)32)17-6-7-18(29)27-20(17)31/h1-5,8-9,11,17,32H,6-7,10H2,(H,26,30)(H,27,29,31) |
| InChIKey | AYQABWSHFPWUGX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|