C23H21F3N4O4 — CID 90692294
1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-[4-methyl-3-(trifluoromethyl)phenyl]urea (PubChem CID 90692294) has the molecular formula C23H21F3N4O4 and a molecular weight of 474.44 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-[4-methyl-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-[4-methyl-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90692294 |
| Molecular Formula | C23H21F3N4O4 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-[4-methyl-3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc(NC(=O)NCc2ccc3c(O)n(C4CCC(=O)NC4=O)cc3c2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H21F3N4O4/c1-12-2-4-15(9-17(12)23(24,25)26)28-22(34)27-10-13-3-5-16-14(8-13)11-30(21(16)33)18-6-7-19(31)29-20(18)32/h2-5,8-9,11,18,33H,6-7,10H2,1H3,(H2,27,28,34)(H,29,31,32) |
| InChIKey | CZYZVJMHGBPRMW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|