C21H17F3N4O4 — CID 90742024
N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 90742024) has the molecular formula C21H17F3N4O4 and a molecular weight of 446.39 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90742024 |
| Molecular Formula | C21H17F3N4O4 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C1CCC(n2cc3cc(CNC(=O)c4ccc(C(F)(F)F)nc4)ccc3c2O)C(=O)N1 |
| InChI | InChI=1S/C21H17F3N4O4/c22-21(23,24)16-5-2-12(9-25-16)18(30)26-8-11-1-3-14-13(7-11)10-28(20(14)32)15-4-6-17(29)27-19(15)31/h1-3,5,7,9-10,15,32H,4,6,8H2,(H,26,30)(H,27,29,31) |
| InChIKey | AJOFVRMVHUBNQI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|