C10H6N2O4 — CID 57035693
5,7-dihydroxy-6H-pyrrolo[3,4-f]isoindole-1,3-dione (PubChem CID 57035693) has the molecular formula C10H6N2O4 and a molecular weight of 218.17 g/mol. Its IUPAC name is 5,7-dihydroxy-6H-pyrrolo[3,4-f]isoindole-1,3-dione.
| Compound Name | 5,7-dihydroxy-6H-pyrrolo[3,4-f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 57035693 |
| Molecular Formula | C10H6N2O4 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 5,7-dihydroxy-6H-pyrrolo[3,4-f]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc3c(O)[nH]c(O)c3cc21 |
| InChI | InChI=1S/C10H6N2O4/c13-7-3-1-4-6(10(16)12-8(4)14)2-5(3)9(15)11-7/h1-2,11,13,15H,(H,12,14,16) |
| InChIKey | IGROENRNSXWEJJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|