C11H6N3O4- — CID 149261578
2-imino-6-methyl-1,3-dioxopyrrolo[3,4-f]isoindol-2-ium-5,7-diolate (PubChem CID 149261578) has the molecular formula C11H6N3O4- and a molecular weight of 244.19 g/mol. Its IUPAC name is 2-imino-6-methyl-1,3-dioxopyrrolo[3,4-f]isoindol-2-ium-5,7-diolate.
| Compound Name | 2-imino-6-methyl-1,3-dioxopyrrolo[3,4-f]isoindol-2-ium-5,7-diolate |
|---|---|
| PubChem CID | 149261578 |
| Molecular Formula | C11H6N3O4- |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-imino-6-methyl-1,3-dioxopyrrolo[3,4-f]isoindol-2-ium-5,7-diolate |
| SMILES | [H]N=[N+]1C(=O)c2cc3c([O-])n(C)c([O-])c3cc2C1=O |
| InChI | InChI=1S/C11H6N3O4/c1-13-8(15)4-2-6-7(3-5(4)9(13)16)11(18)14(12)10(6)17/h2-3,12H,1H3/q-1 |
| InChIKey | XPIIQUUOXSEGTI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|