C13H13N3O4 — CID 135600651
N-acetylimino-2-ethyl-1,3-dihydroxyisoindole-5-carboxamide (PubChem CID 135600651) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is N-acetylimino-2-ethyl-1,3-dihydroxyisoindole-5-carboxamide.
| Compound Name | N-acetylimino-2-ethyl-1,3-dihydroxyisoindole-5-carboxamide |
|---|---|
| PubChem CID | 135600651 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-acetylimino-2-ethyl-1,3-dihydroxyisoindole-5-carboxamide |
| SMILES | CCn1c(O)c2ccc(C(=O)/N=N/C(C)=O)cc2c1O |
| InChI | InChI=1S/C13H13N3O4/c1-3-16-12(19)9-5-4-8(6-10(9)13(16)20)11(18)15-14-7(2)17/h4-6,19-20H,3H2,1-2H3/b15-14+ |
| InChIKey | AHEGICZUUDWQRK-CCEZHUSRSA-N |
| XLogP | 2.21 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|