C20H19N3O4 — CID 2667310
N-benzoylimino-2-butyl-1,3-dihydroxyisoindole-5-carboxamide (PubChem CID 2667310) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-benzoylimino-2-butyl-1,3-dihydroxyisoindole-5-carboxamide.
| Compound Name | N-benzoylimino-2-butyl-1,3-dihydroxyisoindole-5-carboxamide |
|---|---|
| PubChem CID | 2667310 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-benzoylimino-2-butyl-1,3-dihydroxyisoindole-5-carboxamide |
| SMILES | CCCCn1c(O)c2ccc(C(=O)/N=N/C(=O)c3ccccc3)cc2c1O |
| InChI | InChI=1S/C20H19N3O4/c1-2-3-11-23-19(26)15-10-9-14(12-16(15)20(23)27)18(25)22-21-17(24)13-7-5-4-6-8-13/h4-10,12,26-27H,2-3,11H2,1H3/b22-21+ |
| InChIKey | GVHRBPDKRIADTE-QURGRASLSA-N |
| XLogP | 4.29 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|