C21H21N3O4 — CID 135401598
1,3-dihydroxy-N-(4-methylbenzoyl)imino-2-(2-methylpropyl)isoindole-5-carboxamide (PubChem CID 135401598) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1,3-dihydroxy-N-(4-methylbenzoyl)imino-2-(2-methylpropyl)isoindole-5-carboxamide.
| Compound Name | 1,3-dihydroxy-N-(4-methylbenzoyl)imino-2-(2-methylpropyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 135401598 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1,3-dihydroxy-N-(4-methylbenzoyl)imino-2-(2-methylpropyl)isoindole-5-carboxamide |
| SMILES | Cc1ccc(C(=O)/N=N/C(=O)c2ccc3c(O)n(CC(C)C)c(O)c3c2)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-12(2)11-24-20(27)16-9-8-15(10-17(16)21(24)28)19(26)23-22-18(25)14-6-4-13(3)5-7-14/h4-10,12,27-28H,11H2,1-3H3/b23-22+ |
| InChIKey | QDITYMHLWKIHKN-GHVJWSGMSA-N |
| XLogP | 4.45 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|