C14H8N2O4 — CID 136648471
6,8-dihydroxy-7H-isoindolo[5,4-e]isoindole-1,3-dione (PubChem CID 136648471) has the molecular formula C14H8N2O4 and a molecular weight of 268.23 g/mol. Its IUPAC name is 6,8-dihydroxy-7H-isoindolo[5,4-e]isoindole-1,3-dione.
| Compound Name | 6,8-dihydroxy-7H-isoindolo[5,4-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 136648471 |
| Molecular Formula | C14H8N2O4 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 6,8-dihydroxy-7H-isoindolo[5,4-e]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c1ccc1c2ccc2c(O)[nH]c(O)c21 |
| InChI | InChI=1S/C14H8N2O4/c17-11-7-3-1-5-6(10(7)14(20)15-11)2-4-8-9(5)13(19)16-12(8)18/h1-4,15,17,20H,(H,16,18,19) |
| InChIKey | WQMWJRGKFBOPKQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|