C16H17N3O5 — CID 135776333
N-acetylimino-1,3-dihydroxy-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 135776333) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is N-acetylimino-1,3-dihydroxy-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-acetylimino-1,3-dihydroxy-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 135776333 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-acetylimino-1,3-dihydroxy-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | CC(=O)/N=N/C(=O)c1ccc2c(O)n(CC3CCCO3)c(O)c2c1 |
| InChI | InChI=1S/C16H17N3O5/c1-9(20)17-18-14(21)10-4-5-12-13(7-10)16(23)19(15(12)22)8-11-3-2-6-24-11/h4-5,7,11,22-23H,2-3,6,8H2,1H3/b18-17+ |
| InChIKey | HSFBNFJZEUASLZ-ISLYRVAYSA-N |
| XLogP | 2.37 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|