C22H21N3O5 — CID 135815342
1,3-dihydroxy-N-(4-methylbenzoyl)imino-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 135815342) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is 1,3-dihydroxy-N-(4-methylbenzoyl)imino-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | 1,3-dihydroxy-N-(4-methylbenzoyl)imino-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 135815342 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1,3-dihydroxy-N-(4-methylbenzoyl)imino-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | Cc1ccc(C(=O)/N=N/C(=O)c2ccc3c(O)n(CC4CCCO4)c(O)c3c2)cc1 |
| InChI | InChI=1S/C22H21N3O5/c1-13-4-6-14(7-5-13)19(26)23-24-20(27)15-8-9-17-18(11-15)22(29)25(21(17)28)12-16-3-2-10-30-16/h4-9,11,16,28-29H,2-3,10,12H2,1H3/b24-23+ |
| InChIKey | XIVMNWFGLNQVAK-WCWDXBQESA-N |
| XLogP | 3.97 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|