C14H19NO5 — CID 54120412
[3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-2-hydroxypropyl] prop-2-enoate (PubChem CID 54120412) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is [3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-2-hydroxypropyl] prop-2-enoate.
| Compound Name | [3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-2-hydroxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 54120412 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-2-hydroxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)Cn1c(O)c2c(c1O)CCCC2 |
| InChI | InChI=1S/C14H19NO5/c1-2-12(17)20-8-9(16)7-15-13(18)10-5-3-4-6-11(10)14(15)19/h2,9,16,18-19H,1,3-8H2 |
| InChIKey | NNHMTGBYSZCQQZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|