C12H19NO4 — CID 54250504
2-[2-(2-hydroxyethoxy)ethyl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 54250504) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethyl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54250504 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | OCCOCCn1c(O)c2c(c1O)CCCC2 |
| InChI | InChI=1S/C12H19NO4/c14-6-8-17-7-5-13-11(15)9-3-1-2-4-10(9)12(13)16/h14-16H,1-8H2 |
| InChIKey | QWJWPGNKJNGAGE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|