C17H21NO6 — CID 54222576
[3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-2-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 54222576) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is [3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-2-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-2-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 54222576 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | [3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-2-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(Cn1c(O)c2c(c1O)CCCC2)OC(=O)C=C |
| InChI | InChI=1S/C17H21NO6/c1-3-14(19)23-10-11(24-15(20)4-2)9-18-16(21)12-7-5-6-8-13(12)17(18)22/h3-4,11,21-22H,1-2,5-10H2 |
| InChIKey | QDQFYGQNMSPCFD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|