C13H17NO3 — CID 54253502
2-[(1S,5S)-5-hydroxycyclopent-2-en-1-yl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 54253502) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-[(1S,5S)-5-hydroxycyclopent-2-en-1-yl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[(1S,5S)-5-hydroxycyclopent-2-en-1-yl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54253502 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-[(1S,5S)-5-hydroxycyclopent-2-en-1-yl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1[C@H]1C=CC[C@@H]1O)CCCC2 |
| InChI | InChI=1S/C13H17NO3/c15-11-7-3-6-10(11)14-12(16)8-4-1-2-5-9(8)13(14)17/h3,6,10-11,15-17H,1-2,4-5,7H2/t10-,11-/m0/s1 |
| InChIKey | QYKHTOBSVSNSIK-QWRGUYRKSA-N |
| XLogP | 1.64 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|