C29H51NO8S — CID 123295966
7-[2,5-dihydroxy-1-(2-sulfooxyethyl)pyrrol-3-yl]-3,3,5,5,12,12,14,14-octamethylpentadec-8-enoic acid (PubChem CID 123295966) has the molecular formula C29H51NO8S and a molecular weight of 573.79 g/mol. Its IUPAC name is 7-[2,5-dihydroxy-1-(2-sulfooxyethyl)pyrrol-3-yl]-3,3,5,5,12,12,14,14-octamethylpentadec-8-enoic acid.
| Compound Name | 7-[2,5-dihydroxy-1-(2-sulfooxyethyl)pyrrol-3-yl]-3,3,5,5,12,12,14,14-octamethylpentadec-8-enoic acid |
|---|---|
| PubChem CID | 123295966 |
| Molecular Formula | C29H51NO8S |
| Molecular Weight | 573.79 g/mol |
| Exact Mass | 573.33 |
| IUPAC Name | 7-[2,5-dihydroxy-1-(2-sulfooxyethyl)pyrrol-3-yl]-3,3,5,5,12,12,14,14-octamethylpentadec-8-enoic acid |
| SMILES | CC(C)(C)CC(C)(C)CCC=CC(CC(C)(C)CC(C)(C)CC(=O)O)c1cc(O)n(CCOS(=O)(=O)O)c1O |
| InChI | InChI=1S/C29H51NO8S/c1-26(2,3)19-27(4,5)13-11-10-12-21(17-28(6,7)20-29(8,9)18-24(32)33)22-16-23(31)30(25(22)34)14-15-38-39(35,36)37/h10,12,16,21,31,34H,11,13-15,17-20H2,1-9H3,(H,32,33)(H,35,36,37) |
| InChIKey | ZJLNAGGRIOYUAU-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.79 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|