C18H31NO5 — CID 54221992
6-(2,5-dihydroxy-3-octylpyrrol-1-yl)hexaneperoxoic acid (PubChem CID 54221992) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is 6-(2,5-dihydroxy-3-octylpyrrol-1-yl)hexaneperoxoic acid.
| Compound Name | 6-(2,5-dihydroxy-3-octylpyrrol-1-yl)hexaneperoxoic acid |
|---|---|
| PubChem CID | 54221992 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 6-(2,5-dihydroxy-3-octylpyrrol-1-yl)hexaneperoxoic acid |
| SMILES | CCCCCCCCc1cc(O)n(CCCCCC(=O)OO)c1O |
| InChI | InChI=1S/C18H31NO5/c1-2-3-4-5-6-8-11-15-14-16(20)19(18(15)22)13-10-7-9-12-17(21)24-23/h14,20,22-23H,2-13H2,1H3 |
| InChIKey | QDGHZVZXXJPQKA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|