C15H23NO4 — CID 91288827
11-(2,5-dihydroxypyrrol-1-yl)undec-10-enoic acid (PubChem CID 91288827) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 11-(2,5-dihydroxypyrrol-1-yl)undec-10-enoic acid.
| Compound Name | 11-(2,5-dihydroxypyrrol-1-yl)undec-10-enoic acid |
|---|---|
| PubChem CID | 91288827 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 11-(2,5-dihydroxypyrrol-1-yl)undec-10-enoic acid |
| SMILES | O=C(O)CCCCCCCCC=Cn1c(O)ccc1O |
| InChI | InChI=1S/C15H23NO4/c17-13-10-11-14(18)16(13)12-8-6-4-2-1-3-5-7-9-15(19)20/h8,10-12,17-18H,1-7,9H2,(H,19,20) |
| InChIKey | HGXVRSPXIZJNGQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|