C15H23NO4 — CID 90702857
10-(2,5-dihydroxypyrrol-1-yl)undec-2-enoic acid (PubChem CID 90702857) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 10-(2,5-dihydroxypyrrol-1-yl)undec-2-enoic acid.
| Compound Name | 10-(2,5-dihydroxypyrrol-1-yl)undec-2-enoic acid |
|---|---|
| PubChem CID | 90702857 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 10-(2,5-dihydroxypyrrol-1-yl)undec-2-enoic acid |
| SMILES | CC(CCCCCCC=CC(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C15H23NO4/c1-12(16-13(17)10-11-14(16)18)8-6-4-2-3-5-7-9-15(19)20/h7,9-12,17-18H,2-6,8H2,1H3,(H,19,20) |
| InChIKey | LNXIHOHYJVETGQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|