C16H20N2O8 — CID 54365501
bis(2,5-dihydroxypyrrol-1-yl) octanedioate (PubChem CID 54365501) has the molecular formula C16H20N2O8 and a molecular weight of 368.34 g/mol. Its IUPAC name is bis(2,5-dihydroxypyrrol-1-yl) octanedioate.
| Compound Name | bis(2,5-dihydroxypyrrol-1-yl) octanedioate |
|---|---|
| PubChem CID | 54365501 |
| Molecular Formula | C16H20N2O8 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | bis(2,5-dihydroxypyrrol-1-yl) octanedioate |
| SMILES | O=C(CCCCCCC(=O)On1c(O)ccc1O)On1c(O)ccc1O |
| InChI | InChI=1S/C16H20N2O8/c19-11-7-8-12(20)17(11)25-15(23)5-3-1-2-4-6-16(24)26-18-13(21)9-10-14(18)22/h7-10,19-22H,1-6H2 |
| InChIKey | UPMPIZSUYOSNOO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|