C12H17NO4S2 — CID 54293186
(2,5-dihydroxypyrrol-1-yl) 5-(dithiolan-3-yl)pentanoate (PubChem CID 54293186) has the molecular formula C12H17NO4S2 and a molecular weight of 303.40 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 5-(dithiolan-3-yl)pentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 54293186 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 5-(dithiolan-3-yl)pentanoate |
| SMILES | O=C(CCCCC1CCSS1)On1c(O)ccc1O |
| InChI | InChI=1S/C12H17NO4S2/c14-10-5-6-11(15)13(10)17-12(16)4-2-1-3-9-7-8-18-19-9/h5-6,9,14-15H,1-4,7-8H2 |
| InChIKey | RYYQYCJFVHZDDK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|