C12H17NO9S — CID 54186927
8-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-8-oxooctanoic acid (PubChem CID 54186927) has the molecular formula C12H17NO9S and a molecular weight of 351.33 g/mol. Its IUPAC name is 8-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-8-oxooctanoic acid.
| Compound Name | 8-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-8-oxooctanoic acid |
|---|---|
| PubChem CID | 54186927 |
| Molecular Formula | C12H17NO9S |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 8-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C12H17NO9S/c14-9-7-8(23(19,20)21)12(18)13(9)22-11(17)6-4-2-1-3-5-10(15)16/h7,14,18H,1-6H2,(H,15,16)(H,19,20,21) |
| InChIKey | PFSXRQZUQHGVCW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 163.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|