C13H14N2O14S2 — CID 90750600
1-[5-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-5-oxopentanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 90750600) has the molecular formula C13H14N2O14S2 and a molecular weight of 486.39 g/mol. Its IUPAC name is 1-[5-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-5-oxopentanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[5-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-5-oxopentanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 90750600 |
| Molecular Formula | C13H14N2O14S2 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 485.99 |
| IUPAC Name | 1-[5-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-5-oxopentanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C(CCCC(=O)On1c(O)cc(S(=O)(=O)O)c1O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C13H14N2O14S2/c16-8-4-6(30(22,23)24)12(20)14(8)28-10(18)2-1-3-11(19)29-15-9(17)5-7(13(15)21)31(25,26)27/h4-5,16-17,20-21H,1-3H2,(H,22,23,24)(H,25,26,27) |
| InChIKey | LPYIFUXRIPUVKO-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 252.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|