C7H9NO7S — CID 54495103
2,5-dihydroxy-1-propanoyloxypyrrole-3-sulfonic acid (PubChem CID 54495103) has the molecular formula C7H9NO7S and a molecular weight of 251.22 g/mol. Its IUPAC name is 2,5-dihydroxy-1-propanoyloxypyrrole-3-sulfonic acid.
| Compound Name | 2,5-dihydroxy-1-propanoyloxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 54495103 |
| Molecular Formula | C7H9NO7S |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 2,5-dihydroxy-1-propanoyloxypyrrole-3-sulfonic acid |
| SMILES | CCC(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C7H9NO7S/c1-2-6(10)15-8-5(9)3-4(7(8)11)16(12,13)14/h3,9,11H,2H2,1H3,(H,12,13,14) |
| InChIKey | XYMWYSSXWPDAHJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|