C11H8F9NO7S — CID 90692071
2,5-dihydroxy-1-(4,4,5,5,6,6,7,7,7-nonafluoroheptanoyloxy)pyrrole-3-sulfonic acid (PubChem CID 90692071) has the molecular formula C11H8F9NO7S and a molecular weight of 469.23 g/mol. Its IUPAC name is 2,5-dihydroxy-1-(4,4,5,5,6,6,7,7,7-nonafluoroheptanoyloxy)pyrrole-3-sulfonic acid.
| Compound Name | 2,5-dihydroxy-1-(4,4,5,5,6,6,7,7,7-nonafluoroheptanoyloxy)pyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 90692071 |
| Molecular Formula | C11H8F9NO7S |
| Molecular Weight | 469.23 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | 2,5-dihydroxy-1-(4,4,5,5,6,6,7,7,7-nonafluoroheptanoyloxy)pyrrole-3-sulfonic acid |
| SMILES | O=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C11H8F9NO7S/c12-8(13,9(14,15)10(16,17)11(18,19)20)2-1-6(23)28-21-5(22)3-4(7(21)24)29(25,26)27/h3,22,24H,1-2H2,(H,25,26,27) |
| InChIKey | JGVIEHFGFSIIIV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|