C11H8F9NO4 — CID 90845127
(2,5-dihydroxypyrrol-1-yl) 4,4,5,5,6,6,7,7,7-nonafluoroheptanoate (PubChem CID 90845127) has the molecular formula C11H8F9NO4 and a molecular weight of 389.17 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4,4,5,5,6,6,7,7,7-nonafluoroheptanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4,4,5,5,6,6,7,7,7-nonafluoroheptanoate |
|---|---|
| PubChem CID | 90845127 |
| Molecular Formula | C11H8F9NO4 |
| Molecular Weight | 389.17 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4,4,5,5,6,6,7,7,7-nonafluoroheptanoate |
| SMILES | O=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)On1c(O)ccc1O |
| InChI | InChI=1S/C11H8F9NO4/c12-8(13,9(14,15)10(16,17)11(18,19)20)4-3-7(24)25-21-5(22)1-2-6(21)23/h1-2,22-23H,3-4H2 |
| InChIKey | CYMSKRQCPLIQCJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|