C9H9NO4 — CID 91315007
(2,5-dihydroxypyrrol-1-yl) pent-4-ynoate (PubChem CID 91315007) has the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) pent-4-ynoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) pent-4-ynoate |
|---|---|
| PubChem CID | 91315007 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) pent-4-ynoate |
| SMILES | C#CCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C9H9NO4/c1-2-3-4-9(13)14-10-7(11)5-6-8(10)12/h1,5-6,11-12H,3-4H2 |
| InChIKey | QFRPMTAVXKFBSW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|