C8H11NO4 — CID 54133325
(2,5-dihydroxypyrrol-1-yl) butanoate (PubChem CID 54133325) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) butanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) butanoate |
|---|---|
| PubChem CID | 54133325 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) butanoate |
| SMILES | CCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C8H11NO4/c1-2-3-8(12)13-9-6(10)4-5-7(9)11/h4-5,10-11H,2-3H2,1H3 |
| InChIKey | NWVAXQSROMMWEG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |