C18H24N2O14S2 — CID 54456096
1-[10-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-10-oxodecanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 54456096) has the molecular formula C18H24N2O14S2 and a molecular weight of 556.52 g/mol. Its IUPAC name is 1-[10-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-10-oxodecanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[10-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-10-oxodecanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 54456096 |
| Molecular Formula | C18H24N2O14S2 |
| Molecular Weight | 556.52 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | 1-[10-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-10-oxodecanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C(CCCCCCCCC(=O)On1c(O)cc(S(=O)(=O)O)c1O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C18H24N2O14S2/c21-13-9-11(35(27,28)29)17(25)19(13)33-15(23)7-5-3-1-2-4-6-8-16(24)34-20-14(22)10-12(18(20)26)36(30,31)32/h9-10,21-22,25-26H,1-8H2,(H,27,28,29)(H,30,31,32) |
| InChIKey | WYHIXFQMMMNOIW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 252.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.52 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|