C15H18N2O14S2 — CID 91392898
2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)heptanedioic acid (PubChem CID 91392898) has the molecular formula C15H18N2O14S2 and a molecular weight of 514.44 g/mol. Its IUPAC name is 2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)heptanedioic acid.
| Compound Name | 2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)heptanedioic acid |
|---|---|
| PubChem CID | 91392898 |
| Molecular Formula | C15H18N2O14S2 |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | 2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)heptanedioic acid |
| SMILES | O=C(O)CCCCC(C(=O)O)(n1c(O)cc(S(=O)(=O)O)c1O)n1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C15H18N2O14S2/c18-9-5-7(32(26,27)28)12(22)16(9)15(14(24)25,4-2-1-3-11(20)21)17-10(19)6-8(13(17)23)33(29,30)31/h5-6,18-19,22-23H,1-4H2,(H,20,21)(H,24,25)(H,26,27,28)(H,29,30,31) |
| InChIKey | ZKPYUXOPFHCUEF-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 274.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|