C16H20N2O14S2 — CID 90839867
2-deuterio-2,3-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)octanedioic acid (PubChem CID 90839867) has the molecular formula C16H20N2O14S2 and a molecular weight of 529.48 g/mol. Its IUPAC name is 2-deuterio-2,3-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)octanedioic acid.
| Compound Name | 2-deuterio-2,3-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)octanedioic acid |
|---|---|
| PubChem CID | 90839867 |
| Molecular Formula | C16H20N2O14S2 |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 529.04 |
| IUPAC Name | 2-deuterio-2,3-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)octanedioic acid |
| SMILES | [2H]C(C(=O)O)(C(CCCCC(=O)O)n1c(O)cc(S(=O)(=O)O)c1O)n1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C16H20N2O14S2/c19-10-5-8(33(27,28)29)14(23)17(10)7(3-1-2-4-12(21)22)13(16(25)26)18-11(20)6-9(15(18)24)34(30,31)32/h5-7,13,19-20,23-24H,1-4H2,(H,21,22)(H,25,26)(H,27,28,29)(H,30,31,32)/i13D |
| InChIKey | OOBUHEHYGXWXBN-YSOHJTORSA-N |
| XLogP | 0.12 |
| TPSA | 274.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|