C12H17NO9S — CID 91065645
2-(2,5-dihydroxy-3-sulfopyrrol-1-yl)octanedioic acid (PubChem CID 91065645) has the molecular formula C12H17NO9S and a molecular weight of 351.33 g/mol. Its IUPAC name is 2-(2,5-dihydroxy-3-sulfopyrrol-1-yl)octanedioic acid.
| Compound Name | 2-(2,5-dihydroxy-3-sulfopyrrol-1-yl)octanedioic acid |
|---|---|
| PubChem CID | 91065645 |
| Molecular Formula | C12H17NO9S |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 2-(2,5-dihydroxy-3-sulfopyrrol-1-yl)octanedioic acid |
| SMILES | O=C(O)CCCCCC(C(=O)O)n1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C12H17NO9S/c14-9-6-8(23(20,21)22)11(17)13(9)7(12(18)19)4-2-1-3-5-10(15)16/h6-7,14,17H,1-5H2,(H,15,16)(H,18,19)(H,20,21,22) |
| InChIKey | DHRDASDAHJRUBD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 174.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|