C12H17NO6 — CID 57014627
2-(2,5-dihydroxypyrrol-1-yl)octanedioic acid (PubChem CID 57014627) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)octanedioic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)octanedioic acid |
|---|---|
| PubChem CID | 57014627 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)octanedioic acid |
| SMILES | O=C(O)CCCCCC(C(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C12H17NO6/c14-9-6-7-10(15)13(9)8(12(18)19)4-2-1-3-5-11(16)17/h6-8,14-15H,1-5H2,(H,16,17)(H,18,19) |
| InChIKey | SCYKQBSEMIATNJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|