(2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid

C9H11NO6 — CID 90753351

IUPAC(2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid
SMILESO=C(O)CC[C@@H](C(=O)O)n1c(O)ccc1O
InChIInChI=1S/C9H11NO6/c11-6-2-3-7(12)10(6)5(9(15)16)1-4-8(13)14/h2-3,5,11-12H,1,4H2,(H,13,14)(H,15,16)/t5-/m0/s1
InChIKeyOGMIUTPVNVGIQE-YFKPBYRVSA-N
MW229.19 g/mol
LogP0.39
Rot. Bonds5

About (2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid

(2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid (PubChem CID 90753351) has the molecular formula C9H11NO6 and a molecular weight of 229.19 g/mol. Its IUPAC name is (2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid.

Molecular Properties

Compound Name(2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid
PubChem CID90753351
Molecular FormulaC9H11NO6
Molecular Weight229.19 g/mol
Exact Mass229.06
IUPAC Name(2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid
SMILESO=C(O)CC[C@@H](C(=O)O)n1c(O)ccc1O
InChIInChI=1S/C9H11NO6/c11-6-2-3-7(12)10(6)5(9(15)16)1-4-8(13)14/h2-3,5,11-12H,1,4H2,(H,13,14)(H,15,16)/t5-/m0/s1
InChIKeyOGMIUTPVNVGIQE-YFKPBYRVSA-N
XLogP0.39
TPSA119.99 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.19
LogP ≤ 50.39
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze (2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid?
The IUPAC name of (2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid (CID 90753351) is (2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid.
What is the SMILES notation for (2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid?
The canonical SMILES for (2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid is O=C(O)CC[C@@H](C(=O)O)n1c(O)ccc1O.
What is the InChIKey of (2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid?
The InChIKey is OGMIUTPVNVGIQE-YFKPBYRVSA-N. The full InChI is InChI=1S/C9H11NO6/c11-6-2-3-7(12)10(6)5(9(15)16)1-4-8(13)14/h2-3,5,11-12H,1,4H2,(H,13,14)(H,15,16)/t5-/m0/s1.
What are the key properties of (2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid?
(2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid has a molecular weight of 229.19 g/mol, XLogP of 0.39, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,5-dihydroxypyrrol-1-yl)pentanedioic acid is sourced from PubChem (CID 90753351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).