(2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid

C7H9NO4S — CID 54030153

IUPAC(2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid
SMILESO=C(O)[C@H](CS)n1c(O)ccc1O
InChIInChI=1S/C7H9NO4S/c9-5-1-2-6(10)8(5)4(3-13)7(11)12/h1-2,4,9-10,13H,3H2,(H,11,12)/t4-/m0/s1
InChIKeyLEZVMUXXQHKVHD-BYPYZUCNSA-N
MW203.22 g/mol
LogP0.45
Rot. Bonds3

About (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid

(2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid (PubChem CID 54030153) has the molecular formula C7H9NO4S and a molecular weight of 203.22 g/mol. Its IUPAC name is (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid.

Molecular Properties

Compound Name(2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid
PubChem CID54030153
Molecular FormulaC7H9NO4S
Molecular Weight203.22 g/mol
Exact Mass203.03
IUPAC Name(2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid
SMILESO=C(O)[C@H](CS)n1c(O)ccc1O
InChIInChI=1S/C7H9NO4S/c9-5-1-2-6(10)8(5)4(3-13)7(11)12/h1-2,4,9-10,13H,3H2,(H,11,12)/t4-/m0/s1
InChIKeyLEZVMUXXQHKVHD-BYPYZUCNSA-N
XLogP0.45
TPSA82.69 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.22
LogP ≤ 50.45
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid?
The IUPAC name of (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid (CID 54030153) is (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid.
What is the SMILES notation for (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid?
The canonical SMILES for (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid is O=C(O)[C@H](CS)n1c(O)ccc1O.
What is the InChIKey of (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid?
The InChIKey is LEZVMUXXQHKVHD-BYPYZUCNSA-N. The full InChI is InChI=1S/C7H9NO4S/c9-5-1-2-6(10)8(5)4(3-13)7(11)12/h1-2,4,9-10,13H,3H2,(H,11,12)/t4-/m0/s1.
What are the key properties of (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid?
(2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid has a molecular weight of 203.22 g/mol, XLogP of 0.45, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid is sourced from PubChem (CID 54030153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).