C7H9NO4S — CID 54030153
(2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid (PubChem CID 54030153) has the molecular formula C7H9NO4S and a molecular weight of 203.22 g/mol. Its IUPAC name is (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 54030153 |
| Molecular Formula | C7H9NO4S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | (2R)-2-(2,5-dihydroxypyrrol-1-yl)-3-sulfanylpropanoic acid |
| SMILES | O=C(O)[C@H](CS)n1c(O)ccc1O |
| InChI | InChI=1S/C7H9NO4S/c9-5-1-2-6(10)8(5)4(3-13)7(11)12/h1-2,4,9-10,13H,3H2,(H,11,12)/t4-/m0/s1 |
| InChIKey | LEZVMUXXQHKVHD-BYPYZUCNSA-N |
| XLogP | 0.45 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|