C9H14N2O4 — CID 54113363
(2S)-5-amino-2-(2,5-dihydroxypyrrol-1-yl)pentanoic acid (PubChem CID 54113363) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is (2S)-5-amino-2-(2,5-dihydroxypyrrol-1-yl)pentanoic acid.
| Compound Name | (2S)-5-amino-2-(2,5-dihydroxypyrrol-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 54113363 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (2S)-5-amino-2-(2,5-dihydroxypyrrol-1-yl)pentanoic acid |
| SMILES | NCCC[C@@H](C(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C9H14N2O4/c10-5-1-2-6(9(14)15)11-7(12)3-4-8(11)13/h3-4,6,12-13H,1-2,5,10H2,(H,14,15)/t6-/m0/s1 |
| InChIKey | NIQJOGKIIAEILJ-LURJTMIESA-N |
| XLogP | 0.26 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |