2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid

C8H9NO6 — CID 54377837

IUPAC2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid
SMILESO=C(O)CC(C(=O)O)n1c(O)ccc1O
InChIInChI=1S/C8H9NO6/c10-5-1-2-6(11)9(5)4(8(14)15)3-7(12)13/h1-2,4,10-11H,3H2,(H,12,13)(H,14,15)
InChIKeyUXUMACNTISYQAM-UHFFFAOYSA-N
MW215.16 g/mol
LogP-0.00
Rot. Bonds4

About 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid

2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid (PubChem CID 54377837) has the molecular formula C8H9NO6 and a molecular weight of 215.16 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid.

Molecular Properties

Compound Name2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid
PubChem CID54377837
Molecular FormulaC8H9NO6
Molecular Weight215.16 g/mol
Exact Mass215.04
IUPAC Name2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid
SMILESO=C(O)CC(C(=O)O)n1c(O)ccc1O
InChIInChI=1S/C8H9NO6/c10-5-1-2-6(11)9(5)4(8(14)15)3-7(12)13/h1-2,4,10-11H,3H2,(H,12,13)(H,14,15)
InChIKeyUXUMACNTISYQAM-UHFFFAOYSA-N
XLogP-0.00
TPSA119.99 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.16
LogP ≤ 5-0.00
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid?
The IUPAC name of 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid (CID 54377837) is 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid.
What is the SMILES notation for 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid?
The canonical SMILES for 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid is O=C(O)CC(C(=O)O)n1c(O)ccc1O.
What is the InChIKey of 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid?
The InChIKey is UXUMACNTISYQAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO6/c10-5-1-2-6(11)9(5)4(8(14)15)3-7(12)13/h1-2,4,10-11H,3H2,(H,12,13)(H,14,15).
What are the key properties of 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid?
2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid has a molecular weight of 215.16 g/mol, XLogP of -0.00, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid is sourced from PubChem (CID 54377837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).