C8H9NO6 — CID 54377837
2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid (PubChem CID 54377837) has the molecular formula C8H9NO6 and a molecular weight of 215.16 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid |
|---|---|
| PubChem CID | 54377837 |
| Molecular Formula | C8H9NO6 |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C8H9NO6/c10-5-1-2-6(11)9(5)4(8(14)15)3-7(12)13/h1-2,4,10-11H,3H2,(H,12,13)(H,14,15) |
| InChIKey | UXUMACNTISYQAM-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |