C8H9NO4S — CID 57105134
2-(2,5-dihydroxypyrrol-1-yl)-3-oxobutanethioic S-acid (PubChem CID 57105134) has the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-3-oxobutanethioic S-acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-3-oxobutanethioic S-acid |
|---|---|
| PubChem CID | 57105134 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-3-oxobutanethioic S-acid |
| SMILES | CC(=O)C(C(=O)S)n1c(O)ccc1O |
| InChI | InChI=1S/C8H9NO4S/c1-4(10)7(8(13)14)9-5(11)2-3-6(9)12/h2-3,7,11-12H,1H3,(H,13,14) |
| InChIKey | KAGAEIAFIPPCDQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|